Products 256381-04-1
CAS 256381-04-1 is the registry number for tert-Butyl 4-(4-acetylphenyl)piperidine-1-carboxylate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.
Tert-butyl 4-(4-acetylphenyl)piperidine-1-carboxylate (CAS 256381-04-1) is a chemical compound with the molecular formula C18H25NO3 and a molecular weight of 303.4 g/mol. IUPAC name: tert-butyl 4-(4-acetylphenyl)piperidine-1-carboxylate. InChIKey: PZONZCXBOBIIRJ-UHFFFAOYSA-N.
| Molecular formula | C18H25NO3 |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | tert-butyl 4-(4-acetylphenyl)piperidine-1-carboxylate |
| InChIKey | PZONZCXBOBIIRJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C2CCN(CC2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)