CAS 2566173-64-4 is the registry number for (S)–1–(3–Fluorophenyl)–N–methylethan–1–amine hydrochloride. Offered by: GLPBio. Available pack sizes: 100mg.
(1S)-1-(3-fluorophenyl)-N-methylethanamine;hydrochloride (CAS 2566173-64-4) is a chemical compound with the molecular formula C9H13ClFN and a molecular weight of 189.66 g/mol. IUPAC name: (1S)-1-(3-fluorophenyl)-N-methylethanamine;hydrochloride. InChIKey: BCFYXJYCTQUITM-FJXQXJEOSA-N.
| Molecular formula | C9H13ClFN |
|---|---|
| Molecular weight | 189.66 g/mol |
| IUPAC name | (1S)-1-(3-fluorophenyl)-N-methylethanamine;hydrochloride |
| InChIKey | BCFYXJYCTQUITM-FJXQXJEOSA-N |
| SMILES | C[C@@H](C1=CC(=CC=C1)F)NC.Cl |
Computed by PubChem (NCBI)