Products 2569515-88-2
CAS 2569515-88-2 is the registry number for Tanshinoic acid A. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg.
2-(1-carboxy-5-methylnaphthalen-2-yl)-4-methylfuran-3-carboxylic acid (CAS 2569515-88-2) is a chemical compound with the molecular formula C18H14O5 and a molecular weight of 310.3 g/mol. IUPAC name: 2-(1-carboxy-5-methylnaphthalen-2-yl)-4-methylfuran-3-carboxylic acid. InChIKey: XYIAEAPWALFPFD-UHFFFAOYSA-N.
| Molecular formula | C18H14O5 |
|---|---|
| Molecular weight | 310.3 g/mol |
| IUPAC name | 2-(1-carboxy-5-methylnaphthalen-2-yl)-4-methylfuran-3-carboxylic acid |
| InChIKey | XYIAEAPWALFPFD-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC(=C(C2=CC=C1)C(=O)O)C3=C(C(=CO3)C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Tanshinoic acid A, orb1943720