CAS 51794-04-8 is the registry number for Dithranol Impurity 7. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(8-acetyloxy-9-hydroxyanthracen-1-yl) acetate (CAS 51794-04-8) is a chemical compound with the molecular formula C18H14O5 and a molecular weight of 310.3 g/mol. IUPAC name: (8-acetyloxy-9-hydroxyanthracen-1-yl) acetate. InChIKey: VBRLBTHTFWJTRA-UHFFFAOYSA-N.
| Molecular formula | C18H14O5 |
|---|---|
| Molecular weight | 310.3 g/mol |
| IUPAC name | (8-acetyloxy-9-hydroxyanthracen-1-yl) acetate |
| InChIKey | VBRLBTHTFWJTRA-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=CC2=CC3=C(C(=CC=C3)OC(=O)C)C(=C21)O |
Computed by PubChem (NCBI)