Products 6621-92-7
CAS 6621-92-7 is the registry number for ALR-6. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3Z)-3-[(2,4-dihydroxyphenyl)methylidene]-5-(4-methoxyphenyl)furan-2-one (CAS 6621-92-7) is a chemical compound with the molecular formula C18H14O5 and a molecular weight of 310.3 g/mol. IUPAC name: (3Z)-3-[(2,4-dihydroxyphenyl)methylidene]-5-(4-methoxyphenyl)furan-2-one. InChIKey: ZOHPXEDJWXZOLY-JYRVWZFOSA-N.
| Molecular formula | C18H14O5 |
|---|---|
| Molecular weight | 310.3 g/mol |
| IUPAC name | (3Z)-3-[(2,4-dihydroxyphenyl)methylidene]-5-(4-methoxyphenyl)furan-2-one |
| InChIKey | ZOHPXEDJWXZOLY-JYRVWZFOSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C/C(=C/C3=C(C=C(C=C3)O)O)/C(=O)O2 |
Computed by PubChem (NCBI)