Products 438221-05-7

CAS 438221-05-7 is the registry number for 5-(1-Formyl-naphthalen-2-yloxymethyl)-furan-2-carboxylic acid methyl ester. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 5-[(1-formylnaphthalen-2-yl)oxymethyl]furan-2-carboxylate (CAS 438221-05-7) is a chemical compound with the molecular formula C18H14O5 and a molecular weight of 310.3 g/mol. IUPAC name: methyl 5-[(1-formylnaphthalen-2-yl)oxymethyl]furan-2-carboxylate. InChIKey: GFDYAVWTSYEKEB-UHFFFAOYSA-N.

Identity
Molecular formulaC18H14O5
Molecular weight310.3 g/mol
IUPAC namemethyl 5-[(1-formylnaphthalen-2-yl)oxymethyl]furan-2-carboxylate
InChIKeyGFDYAVWTSYEKEB-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=C(O1)COC2=C(C3=CC=CC=C3C=C2)C=O

Computed by PubChem (NCBI)