CAS 374722-15-3 is the registry number for 2-((3,4-dimethoxyphenyl)carbonyl)indane-1,3-dione. Offered by: Biosynth. Available pack sizes: 10g, 25g.
2-(3,4-dimethoxybenzoyl)indene-1,3-dione (CAS 374722-15-3) is a chemical compound with the molecular formula C18H14O5 and a molecular weight of 310.3 g/mol. IUPAC name: 2-(3,4-dimethoxybenzoyl)indene-1,3-dione. InChIKey: HWVAJEYGUMGBMF-UHFFFAOYSA-N.
| Molecular formula | C18H14O5 |
|---|---|
| Molecular weight | 310.3 g/mol |
| IUPAC name | 2-(3,4-dimethoxybenzoyl)indene-1,3-dione |
| InChIKey | HWVAJEYGUMGBMF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)C2C(=O)C3=CC=CC=C3C2=O)OC |
Computed by PubChem (NCBI)