CAS 257632-65-8 is the registry number for Methyl 2-(2-chlorobenzo[d]oxazol-5-yl)acetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-(2-chloro-1,3-benzoxazol-5-yl)acetate (CAS 257632-65-8) is a chemical compound with the molecular formula C10H8ClNO3 and a molecular weight of 225.63 g/mol. IUPAC name: methyl 2-(2-chloro-1,3-benzoxazol-5-yl)acetate. InChIKey: FLPVHMOPFRYKCQ-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO3 |
|---|---|
| Molecular weight | 225.63 g/mol |
| IUPAC name | methyl 2-(2-chloro-1,3-benzoxazol-5-yl)acetate |
| InChIKey | FLPVHMOPFRYKCQ-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC2=C(C=C1)OC(=N2)Cl |
Computed by PubChem (NCBI)