Products 2576586-47-3
CAS 2576586-47-3 is the registry number for NMDA agonist 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R)-2-amino-3-[(7-methylthieno[3,2-b]pyridine-2-carbonyl)amino]propanoic acid (CAS 2576586-47-3) is a chemical compound with the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. IUPAC name: (2R)-2-amino-3-[(7-methylthieno[3,2-b]pyridine-2-carbonyl)amino]propanoic acid. InChIKey: QRAZNSMFVGTRFM-SSDOTTSWSA-N.
| Molecular formula | C12H13N3O3S |
|---|---|
| Molecular weight | 279.32 g/mol |
| IUPAC name | (2R)-2-amino-3-[(7-methylthieno[3,2-b]pyridine-2-carbonyl)amino]propanoic acid |
| InChIKey | QRAZNSMFVGTRFM-SSDOTTSWSA-N |
| SMILES | CC1=C2C(=NC=C1)C=C(S2)C(=O)NC[C@H](C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
NMDA agonist 1, orb2945209