Products 2577447-96-0
CAS 2577447-96-0 is the registry number for Methyl 6-fluoro-3-methylindoline-3-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 6-fluoro-3-methyl-1,2-dihydroindole-3-carboxylate (CAS 2577447-96-0) is a chemical compound with the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. IUPAC name: methyl 6-fluoro-3-methyl-1,2-dihydroindole-3-carboxylate. InChIKey: PKJLFHCVFTXLKL-UHFFFAOYSA-N.
| Molecular formula | C11H12FNO2 |
|---|---|
| Molecular weight | 209.22 g/mol |
| IUPAC name | methyl 6-fluoro-3-methyl-1,2-dihydroindole-3-carboxylate |
| InChIKey | PKJLFHCVFTXLKL-UHFFFAOYSA-N |
| SMILES | CC1(CNC2=C1C=CC(=C2)F)C(=O)OC |
Computed by PubChem (NCBI)