Products 25786-08-7
CAS 25786-08-7 is the registry number for 2-(Dimethylamino)-N-(4-nitrophenyl)acetamide, 97%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
2-(dimethylamino)-N-(4-nitrophenyl)acetamide (CAS 25786-08-7) is a chemical compound with the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. IUPAC name: 2-(dimethylamino)-N-(4-nitrophenyl)acetamide. InChIKey: RAUBZYQVBHPQPD-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O3 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 2-(dimethylamino)-N-(4-nitrophenyl)acetamide |
| InChIKey | RAUBZYQVBHPQPD-UHFFFAOYSA-N |
| SMILES | CN(C)CC(=O)NC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)