CAS 2580230-19-7 appears in our catalog under these names: 2-[2-(trifluoromethyl)pyridin-4-yl]ethan-1-amine hydrochloride, 98%, 98%, 2-(2-(Trifluoromethyl)pyridin-4-yl)ethan-1-amine (hydrochloride), 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
2-[2-(trifluoromethyl)-4-pyridinyl]ethanamine;hydrochloride (CAS 2580230-19-7) is a chemical compound with the molecular formula C8H10ClF3N2 and a molecular weight of 226.62 g/mol. IUPAC name: 2-[2-(trifluoromethyl)-4-pyridinyl]ethanamine;hydrochloride. InChIKey: WEVMBJRSGFIYRJ-UHFFFAOYSA-N.
| Molecular formula | C8H10ClF3N2 |
|---|---|
| Molecular weight | 226.62 g/mol |
| IUPAC name | 2-[2-(trifluoromethyl)-4-pyridinyl]ethanamine;hydrochloride |
| InChIKey | WEVMBJRSGFIYRJ-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1CCN)C(F)(F)F.Cl |
Computed by PubChem (NCBI)