Products 2581222-50-4
CAS 2581222-50-4 is the registry number for 6-Formyl-2-methoxy-4,5-dimethylnicotinonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-formyl-2-methoxy-4,5-dimethylpyridine-3-carbonitrile (CAS 2581222-50-4) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 6-formyl-2-methoxy-4,5-dimethylpyridine-3-carbonitrile. InChIKey: OKUFRFRMDOQOHD-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 6-formyl-2-methoxy-4,5-dimethylpyridine-3-carbonitrile |
| InChIKey | OKUFRFRMDOQOHD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(N=C1C=O)OC)C#N)C |
Computed by PubChem (NCBI)