CAS 2581235-06-3 is the registry number for 5-Cyano-3,4-dimethylpicolinamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-cyano-3,4-dimethylpyridine-2-carboxamide (CAS 2581235-06-3) is a chemical compound with the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. IUPAC name: 5-cyano-3,4-dimethylpyridine-2-carboxamide. InChIKey: MIAVUYWDFPGIFE-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | 5-cyano-3,4-dimethylpyridine-2-carboxamide |
| InChIKey | MIAVUYWDFPGIFE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC=C1C#N)C(=O)N)C |
Computed by PubChem (NCBI)