CAS 25823-49-8 is the registry number for 2H,3H,5H,6H-Benzo(H)cinnolin-3-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5,6-dihydro-2H-benzo[h]cinnolin-3-one (CAS 25823-49-8) is a chemical compound with the molecular formula C12H10N2O and a molecular weight of 198.22 g/mol. IUPAC name: 5,6-dihydro-2H-benzo[h]cinnolin-3-one. InChIKey: DGSJGLOZIUGZSF-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 5,6-dihydro-2H-benzo[h]cinnolin-3-one |
| InChIKey | DGSJGLOZIUGZSF-UHFFFAOYSA-N |
| SMILES | C1CC2=CC(=O)NN=C2C3=CC=CC=C31 |
Computed by PubChem (NCBI)