CAS 25827-94-5 appears in our catalog under these names: 2,6-Diphenylpyrazine, 98%, 2,6-Diphenylpyrazine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,6-diphenylpyrazine (CAS 25827-94-5) is a chemical compound with the molecular formula C16H12N2 and a molecular weight of 232.28 g/mol. IUPAC name: 2,6-diphenylpyrazine. InChIKey: PHTOUDMCYGFCNT-UHFFFAOYSA-N.
| Molecular formula | C16H12N2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | 2,6-diphenylpyrazine |
| InChIKey | PHTOUDMCYGFCNT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=CC(=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)