Products 258353-01-4
CAS 258353-01-4 is the registry number for 2-(2,2,2-Trifluoroethoxy)-5-(trifluoromethyl)aniline. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)aniline (CAS 258353-01-4) is a chemical compound with the molecular formula C9H7F6NO and a molecular weight of 259.15 g/mol. IUPAC name: 2-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)aniline. InChIKey: YNQOGGRDSJWRMW-UHFFFAOYSA-N.
| Molecular formula | C9H7F6NO |
|---|---|
| Molecular weight | 259.15 g/mol |
| IUPAC name | 2-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)aniline |
| InChIKey | YNQOGGRDSJWRMW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)N)OCC(F)(F)F |
Computed by PubChem (NCBI)