CAS 258831-76-4 is the registry number for 5-Ethoxycarbonyl SU 5402 Methyl Ester. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
Ethyl 4-(3-methoxy-3-oxopropyl)-3-methyl-5-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrole-2-carboxylate (CAS 258831-76-4) is a chemical compound with the molecular formula C21H22N2O5 and a molecular weight of 382.4 g/mol. IUPAC name: ethyl 4-(3-methoxy-3-oxopropyl)-3-methyl-5-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrole-2-carboxylate. InChIKey: DSTXIRZFJURXBU-PTNGSMBKSA-N.
| Molecular formula | C21H22N2O5 |
|---|---|
| Molecular weight | 382.4 g/mol |
| IUPAC name | ethyl 4-(3-methoxy-3-oxopropyl)-3-methyl-5-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrole-2-carboxylate |
| InChIKey | DSTXIRZFJURXBU-PTNGSMBKSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(N1)/C=C\2/C3=CC=CC=C3NC2=O)CCC(=O)OC)C |
Computed by PubChem (NCBI)