CAS 283160-17-8 appears in our catalog under these names: (S)-5-Carbamoyl-3-(9h-fluoren-9-ylmethoxycarbonyl-amino)-pentanoic acid, 95%, Fmoc–L–beta–homoglutamine, Fmoc-β-HoGln-OH 97%, (S)-5-Carbamoyl-3-(9H-fluoren-9-ylmethoxycarbonyl-amino)-pentanoic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 5g, 250mg.
(3S)-6-amino-3-(9H-fluoren-9-ylmethoxycarbonylamino)-6-oxohexanoic acid (CAS 283160-17-8) is a chemical compound with the molecular formula C21H22N2O5 and a molecular weight of 382.4 g/mol. IUPAC name: (3S)-6-amino-3-(9H-fluoren-9-ylmethoxycarbonylamino)-6-oxohexanoic acid. InChIKey: GMXKYUGMPJITQT-ZDUSSCGKSA-N.
| Molecular formula | C21H22N2O5 |
|---|---|
| Molecular weight | 382.4 g/mol |
| IUPAC name | (3S)-6-amino-3-(9H-fluoren-9-ylmethoxycarbonylamino)-6-oxohexanoic acid |
| InChIKey | GMXKYUGMPJITQT-ZDUSSCGKSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCC(=O)N)CC(=O)O |
Computed by PubChem (NCBI)