CAS 910056-51-8 appears in our catalog under these names: Fmoc-n-me-gln-oh, 95%, Fmoc–N–Me–Gln–OH, Fmoc-N-Me-Gln-OH 95%, Fmoc-N-Me-Gln-OH, 98%, 98%, Fmoc-N-Me-Gln-OH, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g, 10g, 25g.
(2S)-5-amino-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-5-oxopentanoic acid (CAS 910056-51-8) is a chemical compound with the molecular formula C21H22N2O5 and a molecular weight of 382.4 g/mol. IUPAC name: (2S)-5-amino-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-5-oxopentanoic acid. InChIKey: RKLOXTAEGHPJPW-SFHVURJKSA-N.
| Molecular formula | C21H22N2O5 |
|---|---|
| Molecular weight | 382.4 g/mol |
| IUPAC name | (2S)-5-amino-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-5-oxopentanoic acid |
| InChIKey | RKLOXTAEGHPJPW-SFHVURJKSA-N |
| SMILES | CN([C@@H](CCC(=O)N)C(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)