CAS 87512-31-0 appears in our catalog under these names: Fmoc–Ala–Ala–OH, Fmoc-L-Ala-L-Ala-OH, Fmoc-Ala-Ala-OH, Fmoc-Ala-Ala-OH 98%, Fmoc-Ala-Ala-OH, 98%, 98%. Offered by: GLPBio, Iris Biotech, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 100g, 25g, 5g, 250mg, 500mg, 1000mg, 5000mg.
(2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]propanoic acid (CAS 87512-31-0) is a chemical compound with the molecular formula C21H22N2O5 and a molecular weight of 382.4 g/mol. IUPAC name: (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]propanoic acid. InChIKey: VXGGBPQPMISJCA-STQMWFEESA-N.
| Molecular formula | C21H22N2O5 |
|---|---|
| Molecular weight | 382.4 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]propanoic acid |
| InChIKey | VXGGBPQPMISJCA-STQMWFEESA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](C)C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)