Products 1416793-14-0
CAS 1416793-14-0 appears in our catalog under these names: Fmoc-D-Ala-Ala-OH, 95%, (((9H-Fluoren-9-yl)methoxy)carbonyl)-D-alanyl-L-alanine, ≥95%, ≥95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 250mg, 1g.
(2S)-2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]propanoic acid (CAS 1416793-14-0) is a chemical compound with the molecular formula C21H22N2O5 and a molecular weight of 382.4 g/mol. IUPAC name: (2S)-2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]propanoic acid. InChIKey: VXGGBPQPMISJCA-OLZOCXBDSA-N.
| Molecular formula | C21H22N2O5 |
|---|---|
| Molecular weight | 382.4 g/mol |
| IUPAC name | (2S)-2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]propanoic acid |
| InChIKey | VXGGBPQPMISJCA-OLZOCXBDSA-N |
| SMILES | C[C@H](C(=O)N[C@@H](C)C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)