Products 259105-55-0
CAS 259105-55-0 appears in our catalog under these names: (R)-4-Benzyl-2-(quinolin-8-yl)-4,5-dihydrooxazole, 97%, 97%, (R)-4-Benzyl-2-(quinolin-8-yl)-4,5-dihydrooxazole, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
(4R)-4-benzyl-2-quinolin-8-yl-4,5-dihydro-1,3-oxazole (CAS 259105-55-0) is a chemical compound with the molecular formula C19H16N2O and a molecular weight of 288.3 g/mol. IUPAC name: (4R)-4-benzyl-2-quinolin-8-yl-4,5-dihydro-1,3-oxazole. InChIKey: UJADDXAPWQSGKQ-MRXNPFEDSA-N.
| Molecular formula | C19H16N2O |
|---|---|
| Molecular weight | 288.3 g/mol |
| IUPAC name | (4R)-4-benzyl-2-quinolin-8-yl-4,5-dihydro-1,3-oxazole |
| InChIKey | UJADDXAPWQSGKQ-MRXNPFEDSA-N |
| SMILES | C1[C@H](N=C(O1)C2=CC=CC3=C2N=CC=C3)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)