Products 2594419-41-5
CAS 2594419-41-5 is the registry number for 7-Benzyl-4-hydroxy-2-oxo-1,2,5,6,7,8-hexahydro-1,7-naphthyridine-3-carbonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-benzyl-4-hydroxy-2-oxo-1,5,6,8-tetrahydro-1,7-naphthyridine-3-carbonitrile (CAS 2594419-41-5) is a chemical compound with the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. IUPAC name: 7-benzyl-4-hydroxy-2-oxo-1,5,6,8-tetrahydro-1,7-naphthyridine-3-carbonitrile. InChIKey: MSQMVDLIOYUGLN-UHFFFAOYSA-N.
| Molecular formula | C16H15N3O2 |
|---|---|
| Molecular weight | 281.31 g/mol |
| IUPAC name | 7-benzyl-4-hydroxy-2-oxo-1,5,6,8-tetrahydro-1,7-naphthyridine-3-carbonitrile |
| InChIKey | MSQMVDLIOYUGLN-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1C(=C(C(=O)N2)C#N)O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)