Products 259824-51-6
CAS 259824-51-6 appears in our catalog under these names: Acetaldehyde 2,4-Dinitrophenylhydrazone-d3, >95% (HPLC), Acetaldehyde 2,4-Dinitrophenylhydrazone-3,5,6-d3, 99 atom % D, min 98% Chemical Purity, Acetaldehyde 2，4–Dinitrophenylhydrazone–d3, Acetaldehyde 2,4–Dinitrophenylhydrazone–3,5,6–d3, Acetaldehyde 2,4-Dinitrophenylhydrazone-3,5,6-d3, 99.0%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 50mg, 5mg, 0,05g, 0,01g, 1mg, 5 mg, 1 mg.
2,3,5-trideuterio-N-[(E)-ethylideneamino]-4,6-dinitroaniline (CAS 259824-51-6) is a chemical compound with the molecular formula C8H8N4O4 and a molecular weight of 227.19 g/mol. IUPAC name: 2,3,5-trideuterio-N-[(E)-ethylideneamino]-4,6-dinitroaniline. InChIKey: ONBOQRNOMHHDFB-BOZDYOBDSA-N.
| Molecular formula | C8H8N4O4 |
|---|---|
| Molecular weight | 227.19 g/mol |
| IUPAC name | 2,3,5-trideuterio-N-[(E)-ethylideneamino]-4,6-dinitroaniline |
| InChIKey | ONBOQRNOMHHDFB-BOZDYOBDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N/N=C/C)[N+](=O)[O-])[2H])[N+](=O)[O-])[2H] |
Computed by PubChem (NCBI)