Products 5407-76-1
CAS 5407-76-1 is the registry number for Furazolidone Impurity 1. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
3-[(E)-(5-nitrofuran-2-yl)methylideneamino]-1,3-oxazolidin-2-imine (CAS 5407-76-1) is a chemical compound with the molecular formula C8H8N4O4 and a molecular weight of 224.17 g/mol. IUPAC name: 3-[(E)-(5-nitrofuran-2-yl)methylideneamino]-1,3-oxazolidin-2-imine. InChIKey: JDGUEERJNDLTTL-VRPAOUSYSA-N.
| Molecular formula | C8H8N4O4 |
|---|---|
| Molecular weight | 224.17 g/mol |
| IUPAC name | 3-[(E)-(5-nitrofuran-2-yl)methylideneamino]-1,3-oxazolidin-2-imine |
| InChIKey | JDGUEERJNDLTTL-VRPAOUSYSA-N |
| SMILES | C1COC(=N)N1/N=C/C2=CC=C(O2)[N+](=O)[O-] |
Computed by PubChem (NCBI)