CAS 102838-43-7 appears in our catalog under these names: 2-(3-Methyl-2,6-dioxo-1,2,3,6-tetrahydro-7h-purin-7-yl)acetic acid, 97%, 97%, 2-(3-Methyl-2,6-dioxo-1,2,3,6-tetrahydro-7h-purin-7-yl)acetic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-(3-methyl-2,6-dioxopurin-7-yl)acetic acid (CAS 102838-43-7) is a chemical compound with the molecular formula C8H8N4O4 and a molecular weight of 224.17 g/mol. IUPAC name: 2-(3-methyl-2,6-dioxopurin-7-yl)acetic acid. InChIKey: AGASXISVTOCAIF-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O4 |
|---|---|
| Molecular weight | 224.17 g/mol |
| IUPAC name | 2-(3-methyl-2,6-dioxopurin-7-yl)acetic acid |
| InChIKey | AGASXISVTOCAIF-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)NC1=O)N(C=N2)CC(=O)O |
Computed by PubChem (NCBI)