CAS 61947-85-1 is the registry number for 2,4-Dinitrophenylhydrazine Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(E)-ethylideneamino]-2,4-dinitroaniline (CAS 61947-85-1) is a chemical compound with the molecular formula C8H8N4O4 and a molecular weight of 224.17 g/mol. IUPAC name: N-[(E)-ethylideneamino]-2,4-dinitroaniline. InChIKey: ONBOQRNOMHHDFB-XNWCZRBMSA-N.
| Molecular formula | C8H8N4O4 |
|---|---|
| Molecular weight | 224.17 g/mol |
| IUPAC name | N-[(E)-ethylideneamino]-2,4-dinitroaniline |
| InChIKey | ONBOQRNOMHHDFB-XNWCZRBMSA-N |
| SMILES | C/C=N/NC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)