CAS 332164-33-7 is the registry number for 2-((4-Nitrobenzo[c][1,2,5]oxadiazol-5-yl)amino)ethanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]ethanol (CAS 332164-33-7) is a chemical compound with the molecular formula C8H8N4O4 and a molecular weight of 224.17 g/mol. IUPAC name: 2-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]ethanol. InChIKey: ONQQXCWWUUEILQ-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O4 |
|---|---|
| Molecular weight | 224.17 g/mol |
| IUPAC name | 2-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]ethanol |
| InChIKey | ONQQXCWWUUEILQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=NON=C2C(=C1NCCO)[N+](=O)[O-] |
Computed by PubChem (NCBI)