Products 2600696-66-8
CAS 2600696-66-8 is the registry number for tert-Butyl 2,4-dichloro-3-cyano-5,8-dihydro-1,7-naphthyridine-7(6H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2,4-dichloro-3-cyano-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylate (CAS 2600696-66-8) is a chemical compound with the molecular formula C14H15Cl2N3O2 and a molecular weight of 328.2 g/mol. IUPAC name: tert-butyl 2,4-dichloro-3-cyano-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylate. InChIKey: PDNLASZPSOKQAS-UHFFFAOYSA-N.
| Molecular formula | C14H15Cl2N3O2 |
|---|---|
| Molecular weight | 328.2 g/mol |
| IUPAC name | tert-butyl 2,4-dichloro-3-cyano-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylate |
| InChIKey | PDNLASZPSOKQAS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)N=C(C(=C2Cl)C#N)Cl |
Computed by PubChem (NCBI)