CAS 2639433-74-0 is the registry number for Prothioconazole Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-2-[2-(1-chlorocyclopropyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]phenol (CAS 2639433-74-0) is a chemical compound with the molecular formula C14H15Cl2N3O2 and a molecular weight of 328.2 g/mol. IUPAC name: 3-chloro-2-[2-(1-chlorocyclopropyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]phenol. InChIKey: JQRBOBUTGZOYBJ-UHFFFAOYSA-N.
| Molecular formula | C14H15Cl2N3O2 |
|---|---|
| Molecular weight | 328.2 g/mol |
| IUPAC name | 3-chloro-2-[2-(1-chlorocyclopropyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]phenol |
| InChIKey | JQRBOBUTGZOYBJ-UHFFFAOYSA-N |
| SMILES | C1CC1(C(CC2=C(C=CC=C2Cl)O)(CN3C=NC=N3)O)Cl |
Computed by PubChem (NCBI)