CAS 959800-65-8 is the registry number for Ethyl 1-(2,6-dichlorophenyl)-4-isopropyl-1h-1,2,3-triazole-5-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Ethyl 3-(2,6-dichlorophenyl)-5-propan-2-yltriazole-4-carboxylate (CAS 959800-65-8) is a chemical compound with the molecular formula C14H15Cl2N3O2 and a molecular weight of 328.2 g/mol. IUPAC name: ethyl 3-(2,6-dichlorophenyl)-5-propan-2-yltriazole-4-carboxylate. InChIKey: DQDPZIRMUJBHTI-UHFFFAOYSA-N.
| Molecular formula | C14H15Cl2N3O2 |
|---|---|
| Molecular weight | 328.2 g/mol |
| IUPAC name | ethyl 3-(2,6-dichlorophenyl)-5-propan-2-yltriazole-4-carboxylate |
| InChIKey | DQDPZIRMUJBHTI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=NN1C2=C(C=CC=C2Cl)Cl)C(C)C |
Computed by PubChem (NCBI)