Products 856045-93-7
CAS 856045-93-7 appears in our catalog under these names: Prothioconazole Impurity 2, Prothioconazole-3-hydroxy-desthio. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 0,5mg.
2-chloro-3-[2-(1-chlorocyclopropyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]phenol (CAS 856045-93-7) is a chemical compound with the molecular formula C14H15Cl2N3O2 and a molecular weight of 328.2 g/mol. IUPAC name: 2-chloro-3-[2-(1-chlorocyclopropyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]phenol. InChIKey: OSFCZDFLHQXWKG-UHFFFAOYSA-N.
| Molecular formula | C14H15Cl2N3O2 |
|---|---|
| Molecular weight | 328.2 g/mol |
| IUPAC name | 2-chloro-3-[2-(1-chlorocyclopropyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]phenol |
| InChIKey | OSFCZDFLHQXWKG-UHFFFAOYSA-N |
| SMILES | C1CC1(C(CC2=C(C(=CC=C2)O)Cl)(CN3C=NC=N3)O)Cl |
Computed by PubChem (NCBI)