Products 856045-95-9
CAS 856045-95-9 appears in our catalog under these names: Prothioconazole Impurity 8 (Mixture of Diastereomers), 3-Des-(triazolothiono) 3-(1,2,4-Thiazol-1-yl) 2'-Hydroxy Prothioconazole. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg.
2-(1-chlorocyclopropyl)-1-(2-chlorophenyl)-3-(1,2,4-triazol-1-yl)propane-1,2-diol (CAS 856045-95-9) is a chemical compound with the molecular formula C14H15Cl2N3O2 and a molecular weight of 328.2 g/mol. IUPAC name: 2-(1-chlorocyclopropyl)-1-(2-chlorophenyl)-3-(1,2,4-triazol-1-yl)propane-1,2-diol. InChIKey: JOFJRMIXOWNPNA-UHFFFAOYSA-N.
| Molecular formula | C14H15Cl2N3O2 |
|---|---|
| Molecular weight | 328.2 g/mol |
| IUPAC name | 2-(1-chlorocyclopropyl)-1-(2-chlorophenyl)-3-(1,2,4-triazol-1-yl)propane-1,2-diol |
| InChIKey | JOFJRMIXOWNPNA-UHFFFAOYSA-N |
| SMILES | C1CC1(C(CN2C=NC=N2)(C(C3=CC=CC=C3Cl)O)O)Cl |
Computed by PubChem (NCBI)