CAS 26077-80-5 appears in our catalog under these names: 2-(4-Benzoylphenyl)acetic acid, 95%, 4-Benzoylbenzeneacetic acid, 2-(4-Benzoylphenyl)acetic acid 95%. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 500mg, 50mg, 100mg, 250mg, 1000mg, 1g.
2-(4-benzoylphenyl)acetic acid (CAS 26077-80-5) is a chemical compound with the molecular formula C15H12O3 and a molecular weight of 240.25 g/mol. IUPAC name: 2-(4-benzoylphenyl)acetic acid. InChIKey: ILZOEMNCWIVMLT-UHFFFAOYSA-N.
| Molecular formula | C15H12O3 |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | 2-(4-benzoylphenyl)acetic acid |
| InChIKey | ILZOEMNCWIVMLT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)CC(=O)O |
Computed by PubChem (NCBI)