CAS 261360-70-7 is the registry number for Boc-L-Phe(4-iPr)-OH. Offered by: Iris Biotech. Available pack sizes: 50mg, 250mg.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-propan-2-ylphenyl)propanoic acid (CAS 261360-70-7) is a chemical compound with the molecular formula C17H25NO4 and a molecular weight of 307.4 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-propan-2-ylphenyl)propanoic acid. InChIKey: DAHLPTAIXLYVQD-AWEZNQCLSA-N.
| Molecular formula | C17H25NO4 |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-propan-2-ylphenyl)propanoic acid |
| InChIKey | DAHLPTAIXLYVQD-AWEZNQCLSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)