CAS 261360-76-3 appears in our catalog under these names: Boc-D-Phe(2-Br)-OH, 98%, 98%, Boc-2-bromo-D-phenylalanine, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g.
(2R)-3-(2-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 261360-76-3) is a chemical compound with the molecular formula C14H18BrNO4 and a molecular weight of 344.20 g/mol. IUPAC name: (2R)-3-(2-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: XDJSTMCSOXSTGZ-LLVKDONJSA-N.
| Molecular formula | C14H18BrNO4 |
|---|---|
| Molecular weight | 344.20 g/mol |
| IUPAC name | (2R)-3-(2-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | XDJSTMCSOXSTGZ-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=CC=C1Br)C(=O)O |
Computed by PubChem (NCBI)