CAS 2614-06-4 appears in our catalog under these names: R-Thalidomide, (R)-(+)-Thalidomide, >95% (HPLC), (+)-Thalidomide, ≥97%, ≥97%, (R)-Thalidomide, 99.80%. Offered by: Chemat Brand, TRC, Chemat, MedChemExpress. Available pack sizes: on request, 10mg, 2,5mg, 25mg, 5mg, 100mg, 5 mg, 1 mg.
2-[(3R)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione (CAS 2614-06-4) is a chemical compound with the molecular formula C13H10N2O4 and a molecular weight of 258.23 g/mol. IUPAC name: 2-[(3R)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione. InChIKey: UEJJHQNACJXSKW-SECBINFHSA-N.
| Molecular formula | C13H10N2O4 |
|---|---|
| Molecular weight | 258.23 g/mol |
| IUPAC name | 2-[(3R)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione |
| InChIKey | UEJJHQNACJXSKW-SECBINFHSA-N |
| SMILES | C1CC(=O)NC(=O)[C@@H]1N2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)