Products 2616540-84-0
CAS 2616540-84-0 is the registry number for Thalidomide-methylpyrrolidine. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(2,6-dioxopiperidin-3-yl)-6-methyl-5,7-dihydropyrrolo[3,4-f]isoindole-1,3-dione (CAS 2616540-84-0) is a chemical compound with the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. IUPAC name: 2-(2,6-dioxopiperidin-3-yl)-6-methyl-5,7-dihydropyrrolo[3,4-f]isoindole-1,3-dione. InChIKey: RNXFHBLKGAWWBL-UHFFFAOYSA-N.
| Molecular formula | C16H15N3O4 |
|---|---|
| Molecular weight | 313.31 g/mol |
| IUPAC name | 2-(2,6-dioxopiperidin-3-yl)-6-methyl-5,7-dihydropyrrolo[3,4-f]isoindole-1,3-dione |
| InChIKey | RNXFHBLKGAWWBL-UHFFFAOYSA-N |
| SMILES | CN1CC2=CC3=C(C=C2C1)C(=O)N(C3=O)C4CCC(=O)NC4=O |
Computed by PubChem (NCBI)