Products 261951-80-8
CAS 261951-80-8 appears in our catalog under these names: 3–Fluoro–2–(trifluoromethyl)benzoic acid, 3-Fluoro-2-trifluoromethylbenzoic acid, 98%, 98%, 3-Fluoro-2-(trifluoromethyl)benzoic acid, 98%, 3-Fluoro-2-trifluoromethylbenzoic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 5g, 50mg, 100mg, 250mg, 10g.
3-fluoro-2-(trifluoromethyl)benzoic acid (CAS 261951-80-8) is a chemical compound with the molecular formula C8H4F4O2 and a molecular weight of 208.11 g/mol. IUPAC name: 3-fluoro-2-(trifluoromethyl)benzoic acid. InChIKey: CDGGKKODENBDJO-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O2 |
|---|---|
| Molecular weight | 208.11 g/mol |
| IUPAC name | 3-fluoro-2-(trifluoromethyl)benzoic acid |
| InChIKey | CDGGKKODENBDJO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)