CAS 2621395-65-9 is the registry number for Decahydrocyclopenta[2,1-b:5,1-b']dipyrrole dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,9-diazatricyclo[6.3.0.01,5]undecane;dihydrochloride (CAS 2621395-65-9) is a chemical compound with the molecular formula C9H18Cl2N2 and a molecular weight of 225.16 g/mol. IUPAC name: 4,9-diazatricyclo[6.3.0.01,5]undecane;dihydrochloride. InChIKey: SFSYOESTSRRHHT-UHFFFAOYSA-N.
| Molecular formula | C9H18Cl2N2 |
|---|---|
| Molecular weight | 225.16 g/mol |
| IUPAC name | 4,9-diazatricyclo[6.3.0.01,5]undecane;dihydrochloride |
| InChIKey | SFSYOESTSRRHHT-UHFFFAOYSA-N |
| SMILES | C1CC2C3(C1NCC3)CCN2.Cl.Cl |
Computed by PubChem (NCBI)