CAS 2792201-01-3 appears in our catalog under these names: 3-(Pyrrolidin-1-yl)bicyclo[1.1.1]pentan-1-amine dihydrochloride, 95%, 95%, 3-(Pyrrolidin-1-yl)bicyclo[1.1.1]pentan-1-amine dihydrochloride, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 500mg, 1g, 5g.
3-pyrrolidin-1-ylbicyclo[1.1.1]pentan-1-amine;dihydrochloride (CAS 2792201-01-3) is a chemical compound with the molecular formula C9H18Cl2N2 and a molecular weight of 225.16 g/mol. IUPAC name: 3-pyrrolidin-1-ylbicyclo[1.1.1]pentan-1-amine;dihydrochloride. InChIKey: DEZCCZBAHSCCGY-UHFFFAOYSA-N.
| Molecular formula | C9H18Cl2N2 |
|---|---|
| Molecular weight | 225.16 g/mol |
| IUPAC name | 3-pyrrolidin-1-ylbicyclo[1.1.1]pentan-1-amine;dihydrochloride |
| InChIKey | DEZCCZBAHSCCGY-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C23CC(C2)(C3)N.Cl.Cl |
Computed by PubChem (NCBI)