CAS 2230789-67-8 is the registry number for (1S,4S)-2-Cyclobutyl-2,5-diazabicyclo(2.2.1)heptane dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1S,4S)-2-cyclobutyl-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride (CAS 2230789-67-8) is a chemical compound with the molecular formula C9H18Cl2N2 and a molecular weight of 225.16 g/mol. IUPAC name: (1S,4S)-2-cyclobutyl-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride. InChIKey: SEBSXDFJNNNEMV-VZIDAPDWSA-N.
| Molecular formula | C9H18Cl2N2 |
|---|---|
| Molecular weight | 225.16 g/mol |
| IUPAC name | (1S,4S)-2-cyclobutyl-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride |
| InChIKey | SEBSXDFJNNNEMV-VZIDAPDWSA-N |
| SMILES | C1CC(C1)N2C[C@@H]3C[C@H]2CN3.Cl.Cl |
Computed by PubChem (NCBI)