CAS 1909336-31-7 appears in our catalog under these names: 1-Azatricyclo(3.3.1.1,3,7)decan-4-amine dihydrochloride, 95%, 1-Azatricyclo(3.3.1.1,3,7)decan-4-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-azatricyclo[3.3.1.13,7]decan-4-amine;dihydrochloride (CAS 1909336-31-7) is a chemical compound with the molecular formula C9H18Cl2N2 and a molecular weight of 225.16 g/mol. IUPAC name: 1-azatricyclo[3.3.1.13,7]decan-4-amine;dihydrochloride. InChIKey: ZZPXEBCEQAOPEB-UHFFFAOYSA-N.
| Molecular formula | C9H18Cl2N2 |
|---|---|
| Molecular weight | 225.16 g/mol |
| IUPAC name | 1-azatricyclo[3.3.1.13,7]decan-4-amine;dihydrochloride |
| InChIKey | ZZPXEBCEQAOPEB-UHFFFAOYSA-N |
| SMILES | C1C2CC3CN(C2)CC1C3N.Cl.Cl |
Computed by PubChem (NCBI)