CAS 2126144-06-5 is the registry number for (1S,7S,8R)-2,5-Diazatricyclo(6.2.1.0,2,7)undecane dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1S,7S,8R)-2,5-diazatricyclo[6.2.1.02,7]undecane;dihydrochloride (CAS 2126144-06-5) is a chemical compound with the molecular formula C9H18Cl2N2 and a molecular weight of 225.16 g/mol. IUPAC name: (1S,7S,8R)-2,5-diazatricyclo[6.2.1.02,7]undecane;dihydrochloride. InChIKey: SLFKOEQRYPOZJC-RUWOQTFVSA-N.
| Molecular formula | C9H18Cl2N2 |
|---|---|
| Molecular weight | 225.16 g/mol |
| IUPAC name | (1S,7S,8R)-2,5-diazatricyclo[6.2.1.02,7]undecane;dihydrochloride |
| InChIKey | SLFKOEQRYPOZJC-RUWOQTFVSA-N |
| SMILES | C1C[C@H]2C[C@@H]1[C@@H]3N2CCNC3.Cl.Cl |
Computed by PubChem (NCBI)