CAS 2243502-98-7 is the registry number for (3aR,8aR)-Decahydropyrrolo(3,4-b)pyrrolizine dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3aR,8aR)-1,2,3,3a,5,6,7,7a,8,8a-decahydropyrrolo[3,4-b]pyrrolizine;dihydrochloride (CAS 2243502-98-7) is a chemical compound with the molecular formula C9H18Cl2N2 and a molecular weight of 225.16 g/mol. IUPAC name: (3aR,8aR)-1,2,3,3a,5,6,7,7a,8,8a-decahydropyrrolo[3,4-b]pyrrolizine;dihydrochloride. InChIKey: BBBHMPPXVZRQAP-WIWRVYTLSA-N.
| Molecular formula | C9H18Cl2N2 |
|---|---|
| Molecular weight | 225.16 g/mol |
| IUPAC name | (3aR,8aR)-1,2,3,3a,5,6,7,7a,8,8a-decahydropyrrolo[3,4-b]pyrrolizine;dihydrochloride |
| InChIKey | BBBHMPPXVZRQAP-WIWRVYTLSA-N |
| SMILES | C1CC2C[C@@H]3CNC[C@@H]3N2C1.Cl.Cl |
Computed by PubChem (NCBI)