Products 2623274-48-4
CAS 2623274-48-4 is the registry number for 2-Butyl-6-(9H-carbazol-9-yl)-1H-benzo[de]isoquinoline-1,3(2H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-butyl-6-carbazol-9-ylbenzo[de]isoquinoline-1,3-dione (CAS 2623274-48-4) is a chemical compound with the molecular formula C28H22N2O2 and a molecular weight of 418.5 g/mol. IUPAC name: 2-butyl-6-carbazol-9-ylbenzo[de]isoquinoline-1,3-dione. InChIKey: JVOMFQRRIQAXMF-UHFFFAOYSA-N.
| Molecular formula | C28H22N2O2 |
|---|---|
| Molecular weight | 418.5 g/mol |
| IUPAC name | 2-butyl-6-carbazol-9-ylbenzo[de]isoquinoline-1,3-dione |
| InChIKey | JVOMFQRRIQAXMF-UHFFFAOYSA-N |
| SMILES | CCCCN1C(=O)C2=C3C(=C(C=C2)N4C5=CC=CC=C5C6=CC=CC=C64)C=CC=C3C1=O |
Computed by PubChem (NCBI)