CAS 8005-40-1 is the registry number for n-Hydroxy Succinate. Offered by: TRC. Available pack sizes: 5g.
1,5-bis(4-methylanilino)anthracene-9,10-dione (CAS 8005-40-1) is a chemical compound with the molecular formula C28H22N2O2 and a molecular weight of 418.5 g/mol. IUPAC name: 1,5-bis(4-methylanilino)anthracene-9,10-dione. InChIKey: ZKIVUFFTMWIBCO-UHFFFAOYSA-N.
| Molecular formula | C28H22N2O2 |
|---|---|
| Molecular weight | 418.5 g/mol |
| IUPAC name | 1,5-bis(4-methylanilino)anthracene-9,10-dione |
| InChIKey | ZKIVUFFTMWIBCO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=CC=CC3=C2C(=O)C4=C(C3=O)C(=CC=C4)NC5=CC=C(C=C5)C |
Computed by PubChem (NCBI)