Products 6737-68-4

CAS 6737-68-4 is the registry number for Solvent Blue 101 (Technical Grade). Offered by: TRC. Available pack sizes: 1g, 2,5g, 5g.

Structural formula: {0} (CAS {1})

1,4-bis(2-methylanilino)anthracene-9,10-dione (CAS 6737-68-4) is a chemical compound with the molecular formula C28H22N2O2 and a molecular weight of 418.5 g/mol. IUPAC name: 1,4-bis(2-methylanilino)anthracene-9,10-dione. InChIKey: OLJXWJUQRAOAMD-UHFFFAOYSA-N.

Identity
Molecular formulaC28H22N2O2
Molecular weight418.5 g/mol
IUPAC name1,4-bis(2-methylanilino)anthracene-9,10-dione
InChIKeyOLJXWJUQRAOAMD-UHFFFAOYSA-N
SMILESCC1=CC=CC=C1NC2=C3C(=C(C=C2)NC4=CC=CC=C4C)C(=O)C5=CC=CC=C5C3=O

Computed by PubChem (NCBI)