CAS 497061-20-8 is the registry number for 4-(1-(4-methoxyphenyl)-4,5-diphenylimidazol-2-yl)phenol. Offered by: Biosynth. Available pack sizes: 250mg.
4-[1-(4-methoxyphenyl)-4,5-diphenylimidazol-2-yl]phenol (CAS 497061-20-8) is a chemical compound with the molecular formula C28H22N2O2 and a molecular weight of 418.5 g/mol. IUPAC name: 4-[1-(4-methoxyphenyl)-4,5-diphenylimidazol-2-yl]phenol. InChIKey: LYBZRNXUSKCTPH-UHFFFAOYSA-N.
| Molecular formula | C28H22N2O2 |
|---|---|
| Molecular weight | 418.5 g/mol |
| IUPAC name | 4-[1-(4-methoxyphenyl)-4,5-diphenylimidazol-2-yl]phenol |
| InChIKey | LYBZRNXUSKCTPH-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N2C(=C(N=C2C3=CC=C(C=C3)O)C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)